PRODUCT Properties
| Boiling point: | 337.8±25.0 °C(Predicted) | 
                                    
| Density | 1.008±0.06 g/cm3(Predicted) | 
                                    
| refractive index | 1.5470 to 1.5510 | 
                                    
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | 
                                    
| form | clear liquid | 
                                    
| pka | 5.42±0.50(Predicted) | 
                                    
| color | Colorless to Light orange to Yellow | 
                                    
| InChI | InChI=1S/C12H16N2/c1-3-14(9-5-8-13)12-7-4-6-11(2)10-12/h4,6-7,10H,3,5,9H2,1-2H3 | 
                                    
| InChIKey | NPCCPMHHNIOSHL-UHFFFAOYSA-N | 
                                    
| SMILES | C(#N)CCN(CC)C1=CC=CC(C)=C1 | 
                                    
| CAS DataBase Reference | 148-69-6(CAS DataBase Reference) | 
                                    
| EPA Substance Registry System | Propanenitrile, 3-[ethyl(3-methylphenyl)amino]- (148-69-6) | 
                                    
Description and Uses
N-Ethyl-N-cyanoethyl-m-toluidine can be used as an intermediate for disperse red 65, 88, 153, 179 and other dyes.
Safety
| Symbol(GHS) | ![]() GHS06  | 
                                    
| Signal word | Danger | 
| Hazard statements | H301 | 
| Precautionary statements | P264-P270-P301+P310-P321-P330-P405-P501 | 
| RTECS | TZ4695000 | 
| HS Code | 2926907090 | 







