A4038412
                    2-(N-Ethyl-N-m-toluidino)ethanol , ≥98% , 91-88-3
                            Synonym(s):
N-Ethyl-N-(2-hydroxyethyl)-m-toluidine
                            
                        
                CAS NO.:91-88-3
Empirical Formula: C11H17NO
Molecular Weight: 179.26
MDL number: MFCD00002849
EINECS: 202-105-9
| Pack Size | Price | Stock | Quantity | 
| 25G | RMB33.60 | In Stock | 
                                                 | 
                                        
| 100G | RMB60.00 | In Stock | 
                                                 | 
                                        
| 500G | RMB255.20 | In Stock | 
                                                 | 
                                        
| 2.5kg | RMB1039.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | -19 °C | 
                                    
| Boiling point: | 114-115 °C/1 mmHg (lit.) | 
                                    
| Density | 1.019 g/mL at 25 °C (lit.) | 
                                    
| refractive index | n | 
                                    
| Flash point: | >230 °F | 
                                    
| storage temp. | Sealed in dry,Room Temperature | 
                                    
| form | powder to lump to clear liquid | 
                                    
| pka | 14.67±0.10(Predicted) | 
                                    
| color | White or Colorless to Yellow to Orange | 
                                    
| Water Solubility | insoluble | 
                                    
| InChI | InChI=1S/C11H17NO/c1-3-12(7-8-13)11-6-4-5-10(2)9-11/h4-6,9,13H,3,7-8H2,1-2H3 | 
                                    
| InChIKey | KRNUKKZDGDAWBF-UHFFFAOYSA-N | 
                                    
| SMILES | C(O)CN(CC)C1=CC=CC(C)=C1 | 
                                    
| CAS DataBase Reference | 91-88-3(CAS DataBase Reference) | 
                                    
| NIST Chemistry Reference | Ethanol, 2-[ethyl(3-methylphenyl)amino]-(91-88-3) | 
                                    
| EPA Substance Registry System | 2-(N-Ethyl-m-toluidino)ethanol (91-88-3) | 
                                    
Description and Uses
2-(N-Ethyl-N-m-toluidino)ethanol may be used in chemical synthesis studies.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H302 | 
| Precautionary statements | P301+P312+P330 | 
| Hazard Codes | Xn | 
| Risk Statements | 22-41-36/37/38 | 
| Safety Statements | 26-39-37/39 | 
| WGK Germany | 2 | 
| RTECS | KL1320000 | 
| HS Code | 2922190090 | 







