PRODUCT Properties
| Boiling point: | 161-162 °C(lit.) |
| Density | 0.770 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 171 °F |
| storage temp. | 2-8°C |
| form | Liquid |
| pka | 5.40±0.50(Predicted) |
| InChI | InChI=1S/C16H19N/c1-3-17(13-15-9-5-4-6-10-15)16-11-7-8-14(2)12-16/h4-12H,3,13H2,1-2H3 |
| InChIKey | VIACAIAQHPLINF-UHFFFAOYSA-N |
| SMILES | C1(CN(CC)C2=CC=CC(C)=C2)=CC=CC=C1 |
| CAS DataBase Reference | 119-94-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenemethanamine, n-ethyl-n-(3-methylphenyl)-(119-94-8) |
| EPA Substance Registry System | N-Benzyl-N-ethyl-m-toluidine (119-94-8) |
Description and Uses
Ethylbenzyltoluidine is a yellowish to lightbrown liquid with an unpleasant odor. Boilingpoint = 230℃; Flash point = 167℃. Insoluble in water.
Ethylbenzyltoluidine can be used as an intermediate for acid blue 90, 91, 109 and other dyes.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Warning |
| Hazard statements | H227-H301-H311-H331 |
| Precautionary statements | P210e-P261-P280-P301+P310a-P405-P501a |
| Hazard Codes | T |
| Risk Statements | 23/24/25 |
| Safety Statements | 23-26-36/37/39-45 |
| RIDADR | UN 2753 6.1/PG 3 |
| WGK Germany | 2 |
| TSCA | Yes |
| HazardClass | 6.1 |
