5-Nitro-2-furaldehyde , >98.0%(GC) , 698-63-5
Synonym(s):
5-Nitrofurfural
CAS NO.:698-63-5
Empirical Formula: C5H3NO4
Molecular Weight: 141.08
MDL number: MFCD00003230
EINECS: 211-816-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB39.20 | In Stock |
|
| 10g | RMB83.20 | In Stock |
|
| 25G | RMB147.20 | In Stock |
|
| 100G | RMB474.40 | In Stock |
|
| 500g | RMB1697.60 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 37-39 °C(lit.) |
| Boiling point: | 121 °C10 mm Hg(lit.) |
| Density | 1.349 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 92 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly) |
| form | Crystalline Low Melting Solid |
| color | Yellow to brown |
| Water Solubility | sparingly soluble |
| Sensitive | Air & Light Sensitive |
| BRN | 120539 |
| InChI | 1S/C5H3NO4/c7-3-4-1-2-5(10-4)6(8)9/h1-3H |
| InChIKey | SXINBFXPADXIEY-UHFFFAOYSA-N |
| SMILES | [H]C(=O)c1ccc(o1)[N+]([O-])=O |
| CAS DataBase Reference | 698-63-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Furancarboxaldehyde, 5-nitro-(698-63-5) |
Description and Uses
Nitrofuran carboxaldehyde (NFC) is used to synthesize many drugs and chemicals such as nifuraldezone, puraguanidine, nifuratrone, furmethoxadone, etc. Furfural the main structure of NFC was determined many years ago to be a byproduct of formic acid synthesis. Furfural is produced from agricultural byproducts such as sugarcane bagasse and corncobs.
NFC and its derivatives have antibacterial and antifungal activities. They destroy both gram-positive and gram-negative organisms such as Staphylococcus aureus, Salmonella schotmuelleri, Pseudomonas aeruginosa, Proteus vulgaris, Escherichia coli, and Streptococcus pyogenes. They may be used as antibacterial agents in a prophylactic manner, for example, in cleaning and disinfecting products. This compound also has antitrichomonal and antifungal activities.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Danger |
| Hazard statements | H228 |
| Precautionary statements | P210 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | F,Xi,Xn |
| Risk Statements | 11-68-10 |
| Safety Statements | 16-36/37 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| RTECS | LT7200000 |
| Hazard Note | Irritant |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29321900 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Flam. Sol. 1 |
| Hazardous Substances Data | 698-63-5(Hazardous Substances Data) |






