5-Nitro-2-furancarboxylic Acid , 98% , 645-12-5
Synonym(s):
5-Nitrofuran-2-carboxylic acid
CAS NO.:645-12-5
Empirical Formula: C5H3NO5
Molecular Weight: 157.08
MDL number: MFCD00003240
EINECS: 211-432-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB60.80 | In Stock |
|
| 5G | RMB196.80 | In Stock |
|
| 25g | RMB835.20 | In Stock |
|
| 100g | RMB2879.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 185-189 °C (lit.) |
| Boiling point: | 281.7°C (rough estimate) |
| Density | 1.8109 (rough estimate) |
| refractive index | 1.4798 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 2.06±0.10(Predicted) |
| color | White to Light Yellow |
| Water Solubility | Slightly soluble in water. |
| BRN | 139373 |
| InChI | InChI=1S/C5H3NO5/c7-5(8)3-1-2-4(11-3)6(9)10/h1-2H,(H,7,8) |
| InChIKey | IODMEDPPCXSFLD-UHFFFAOYSA-N |
| SMILES | O1C([N+]([O-])=O)=CC=C1C(O)=O |
| CAS DataBase Reference | 645-12-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Nitrofuran-2-carboxylic acid(645-12-5) |
Description and Uses
5-Nitro-2-furoic acid is a representative of 2-substituted 5-nitrofurans. A number of nitrofurans have been used as antibacterial, antiprotozoal, and anthelmintic drugs in humans and animals. 2-Substituted 5-nitrofurans have been used worldwide as human and veterinary medicines, food preservatives, and feed additives, and they are utilized in human medicine as antibacterial agents. Therefore, the relationship between the antibacterial effect and the mutagenicity of these compounds and their oxidized metabolites is important. Comparison of the antibacterial effects and genotoxic potencies of nitrofuran drugs and their oxidative metabolites may provide a new direction for selecting nitrofuran drugs for human use.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H341 |
| Precautionary statements | P305+P351+P338-P201-P202-P280-P308+P313-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 68-36/37/38-40 |
| Safety Statements | 37/39-36/37-36-22 |
| WGK Germany | 3 |
| RTECS | LV2012000 |
| HS Code | 2932.19.5100 |
| Storage Class | 11 - Combustible Solids |







