A6277512
<i>N</i>-(<i>tert</i>-Butoxycarbonyl)-<small>L</small>-aspartic Acid , >97.0%(HPLC) , 13726-67-5
Synonym(s):
N-(tert-Butoxycarbonyl)-L -aspartic acid;Boc-L -aspartic acid;Boc-Asp-OH;N-α-t.-Boc-L-aspartic acid
CAS NO.:13726-67-5
Empirical Formula: C9H15NO6
Molecular Weight: 233.22
MDL number: MFCD00037279
EINECS: 237-294-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 1g | RMB23.20 | In Stock |
|
| 25g | RMB72.00 | In Stock |
|
| 100g | RMB216.80 | In Stock |
|
| 500g | RMB925.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 116-118 °C(lit.) |
| alpha | -6 º (c=1, MeOH) |
| Boiling point: | 375.46°C (rough estimate) |
| Density | 1.3397 (rough estimate) |
| refractive index | 1.4640 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 3.77±0.23(Predicted) |
| form | Crystalline Powder |
| color | White to off-white |
| optical activity | [α]20/D 6.0°, c = 1 in methanol |
| BRN | 1913973 |
| Major Application | peptide synthesis |
| InChI | 1S/C9H15NO6/c1-9(2,3)16-8(15)10-5(7(13)14)4-6(11)12/h5H,4H2,1-3H3,(H,10,15)(H,11,12)(H,13,14)/t5-/m0/s1 |
| InChIKey | KAJBMCZQVSQJDE-YFKPBYRVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(O)=O)C(O)=O |
| CAS DataBase Reference | 13726-67-5(CAS DataBase Reference) |
Description and Uses
N-Boc-L-aspartic acid is an N-Boc-protected form of L-Aspartic acid (A790024). L-Aspartic acid is a nonessential amino acid that is used to biosynthesize other amino acids within the human body. L-Aspartic acid also increases membrane conductance of mammalian neurons by voltage-dependent means, causing depolarization and nerve impulses that travel to key areas of the central nervous system.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| HS Code | 2924 19 00 |
| Storage Class | 11 - Combustible Solids |







