A6278212
<i>N</i>,<i>N</i>-Diethylacrylamide (stabilized with MEHQ) , 98%(including 500 ± 50ppmmmhq stabilizer) , 2675-94-7
Synonym(s):
N,N-Diethyl-2-propenamide;Acrylic acid diethylamide;DEAA;DEAAm;DEAM
| Pack Size | Price | Stock | Quantity |
| 25G | RMB120.80 | In Stock |
|
| 100G | RMB308.00 | In Stock |
|
| 500G | RMB879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 93℃/19mm |
| Boiling point: | 93-95°C 10mm |
| Density | 0.924 at 25 °C |
| vapor pressure | 0.2-47.329Pa at 11.67-34.92℃ |
| refractive index | 1.4676 (589.3 nm 20℃) |
| Flash point: | 88℃ |
| storage temp. | 2-8°C |
| Water Solubility | Soluble in water |
| form | Liquid |
| pka | -0.77±0.70(Predicted) |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C7H13NO/c1-4-7(9)8(5-2)6-3/h4H,1,5-6H2,2-3H3 |
| InChIKey | OVHHHVAVHBHXAK-UHFFFAOYSA-N |
| SMILES | C(N(CC)CC)(=O)C=C |
| LogP | 0.61-0.84 at 23-30℃ and pH7.17-7.28 |
| Surface tension | 66-67.6mN/m at 1g/L and 20-20.05℃ |
Description and Uses
Acrylamide monomer used to make polymers for drug delivery; thermal responsive polymers; and solutions with specifically tuned LCSTs.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 20/21/22-36/37/38-51-36-22 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN 1993 / PGIII |
| WGK Germany | 3 |
| RTECS | AS3471000 |
| HS Code | 29241990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |





