A6279712
2-Nitrophenylsulfenyl Chloride [<i>N</i>-Protecting Agent for Peptides Research] , >95.0% , 7669-54-7
CAS NO.:7669-54-7
Empirical Formula: C6H4ClNO2S
Molecular Weight: 189.62
MDL number: MFCD00007128
EINECS: 231-644-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB74.40 | In Stock |
|
| 25G | RMB234.40 | In Stock |
|
| 100G | RMB775.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 70-75 °C |
| Boiling point: | 350.0±25.0 °C(Predicted) |
| Density | 1.492 (estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | 2-8°C |
| form | Crystalline Powder or Needles |
| color | Yellow to gold |
| Water Solubility | decomposes |
| Sensitive | Moisture Sensitive |
| BRN | 473741 |
| InChI | InChI=1S/C6H4ClNO2S/c7-11-6-4-2-1-3-5(6)8(9)10/h1-4H |
| InChIKey | NTNKNFHIAFDCSJ-UHFFFAOYSA-N |
| SMILES | C1(SCl)=CC=CC=C1[N+]([O-])=O |
| CAS DataBase Reference | 7669-54-7(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenesulfenyl chloride, 2-nitro- (7669-54-7) |
Description and Uses
2-Nitrobenzenesulfenyl Chloride is used in the synthesis of α-amino phosphonic acids
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H318 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P405-P501a |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 36/39-45-36/37/39-26 |
| RIDADR | 3261 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29309090 |

![2-Nitrophenylsulfenyl Chloride [<i>N</i>-Protecting Agent for Peptides Research]](https://img.chemicalbook.com/CAS/GIF/7669-54-7.gif)


