A6280112
<i>N</i>-(<i>tert</i>-Butoxycarbonyl)-4-aminobutyric Acid , >98.0%(T) , 57294-38-9
Synonym(s):
γ-(Boc-amino)butyric acid;4-(tert-Butoxycarbonylamino)butyric acid;Boc-GABA
CAS NO.：57294-38-9
Empirical Formula: C9H17NO4
Molecular Weight: 203.24
MDL number: MFCD00037313
EINECS: 628-652-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB30.40 | In Stock |
|
| 25G | RMB86.40 | In Stock |
|
| 100G | RMB284.00 | In Stock |
|
| 500g | RMB1136.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 55-59 °C |
| Boiling point: | 78-82 °C0.2 mm Hg(lit.) |
| Density | 1.1886 (rough estimate) |
| refractive index | 1.4315 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Powder |
| pka | 4.70±0.10(Predicted) |
| color | White to off-white |
| BRN | 1869578 |
| InChI | InChI=1S/C9H17NO4/c1-9(2,3)14-8(13)10-6-4-5-7(11)12/h4-6H2,1-3H3,(H,10,13)(H,11,12) |
| InChIKey | HIDJWBGOQFTDLU-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCCNC(OC(C)(C)C)=O |
| CAS DataBase Reference | 57294-38-9(CAS DataBase Reference) |
Description and Uses
N-Boc-gamma-aminobutyric Acid is used in the preparation of isopropyl-methylcyclohexyl aminobutyrate as a potential anticonvulsant.
Safety
| Hazard Codes | Xi |
| Risk Statements | 44-36/37/38-22 |
| Safety Statements | 37/39-26-24/25 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 2924 19 00 |
| HazardClass | IRRITANT |
