A6287112
<i>N</i>-Methylsuccinimide , >98.0%(GC) , 1121-07-9
CAS NO.：1121-07-9
Empirical Formula: C5H7NO2
Molecular Weight: 113.11
MDL number: MFCD00005517
EINECS: 628-414-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB103.20 | In Stock |
|
| 25G | RMB388.00 | In Stock |
|
| 100g | RMB1424.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 61-70 °C(lit.) |
| Boiling point: | 234-235 °C(lit.) |
| Density | 1.2416 (rough estimate) |
| refractive index | 1.4790 (estimate) |
| Flash point: | 234-235°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | -1.34±0.20(Predicted) |
| color | Off-White |
| Sensitive | Moisture Sensitive |
| BRN | 110534 |
| InChI | InChI=1S/C5H7NO2/c1-6-4(7)2-3-5(6)8/h2-3H2,1H3 |
| InChIKey | KYEACNNYFNZCST-UHFFFAOYSA-N |
| SMILES | N1(C)C(=O)CCC1=O |
| CAS DataBase Reference | 1121-07-9(CAS DataBase Reference) |
Description and Uses
N-Methylsuccinimide is used as a model compound to investigate the mechanism of enolization step by density-functional theory (DFT) calculations. N-Methylsuccinimide is a metabolite of N-methyl-2-pyrrolidone (NMP) and its presence in plasma and urine can be used as a biomarker of exposure to NMP
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38-41 |
| Safety Statements | 26-36/37 |
| WGK Germany | 2 |
| RTECS | UY1028650 |
| HS Code | 2925.19.9100 |
