A6294612
N-Succinimidyl S-Acetylthioglycolate , >94.0%(GC) , 76931-93-6
Synonym(s):
N-Succinimidyl (acetylthio)acetate;N-Succinimidyl S-acetylthioglycolate;N-Succinimidyl-S-acetylthioacetate;S-Acetylthioglycolic acid NHS ester;SATA
CAS NO.:76931-93-6
Empirical Formula: C8H9NO5S
Molecular Weight: 231.23
MDL number: MFCD00036891
EINECS: 678-479-6
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB196.80 | In Stock |
|
| 100MG | RMB247.20 | In Stock |
|
| 250MG | RMB541.60 | In Stock |
|
| 500mg | RMB943.20 | In Stock |
|
| 1G | RMB1104.00 | In Stock |
|
| 5G | RMB3313.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 84-89 °C |
| Boiling point: | 337.3±44.0 °C(Predicted) |
| Density | 1.46±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | acetonitrile: 50 mg/mL |
| form | powder |
| color | White to Off-White |
| BRN | 7815491 |
| Stability: | Moisture Sensitive |
| InChI | InChI=1S/C8H9NO5S/c1-5(10)15-4-8(13)14-9-6(11)2-3-7(9)12/h2-4H2,1H3 |
| InChIKey | FLCQLSRLQIPNLM-UHFFFAOYSA-N |
| SMILES | C(ON1C(=O)CCC1=O)(=O)CSC(C)=O |
Description and Uses
Thiolating reagent for primary amines; thiol can be deprotected under mild conditions. Typically, couples initially to a molecule containing primary amine by amide bond buffered at pH 7.5. Deprotection may be accomplished with 0.05 M hydroxylamine at neutral pH. Useful for preparation of enzyme immunoconjugates and hapten carrier molecule conjugates.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 25/26 |
| WGK Germany | 3 |
| F | 3-10-23 |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |






