A6307412
<i>N</i>-(2-Hydroxyethyl)iminodiacetic Acid , >98.0%(T) , 93-62-9
Synonym(s):
Ethanol diglycine
CAS NO.：93-62-9
Empirical Formula: C6H11NO5
Molecular Weight: 177.16
MDL number: MFCD00004293
EINECS: 202-263-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB66.40 | In Stock |
|
| 5G | RMB237.60 | In Stock |
|
| 25g | RMB675.20 | In Stock |
|
| 100g | RMB2050.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 178 °C (lit.) |
| Boiling point: | 309.06°C (rough estimate) |
| Density | 1.4347 (rough estimate) |
| vapor pressure | 8.398hPa at 21.1℃ |
| refractive index | 1.4230 (estimate) |
| storage temp. | 2-8°C, protect from light |
| solubility | 0.1 M NaOH: 50 mg/mL, clear |
| pka | pK1:2.2;pK2:8.65 (25°C,μ=0.1) |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | 18.61g/L at 25℃ |
| BRN | 1780628 |
| InChI | InChI=1S/C6H11NO5/c8-2-1-7(3-5(9)10)4-6(11)12/h8H,1-4H2,(H,9,10)(H,11,12) |
| InChIKey | JYXGIOKAKDAARW-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CN(CC(O)=O)CCO |
| LogP | -1.17 at 25℃ |
| CAS DataBase Reference | 93-62-9(CAS DataBase Reference) |
| EPA Substance Registry System | N-(2-Hydroxyethyl)iminodiacetic acid (93-62-9) |
Description and Uses
N-(2-Hydroxyethyl)iminodiacetic Acid (cas# 93-62-9) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | AI1925000 |
| HS Code | 29252900 |
