A6309612
5-Norbornene-2-<i>exo</i>,3-<i>exo</i>-dimethanol , >97.0%(GC) , 699-95-6
| Pack Size | Price | Stock | Quantity |
| 200MG | RMB111.20 | In Stock |
|
| 1G | RMB360.80 | In Stock |
|
| 5G | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 53 °C |
| Boiling point: | 97 °C/20 mmHg(lit.) |
| Density | 1.027 g/mL at 25 °C(lit.) |
| refractive index | n20/D 1.523(lit.) |
| Flash point: | 113 °C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Almost white |
| InChI | 1S/C9H14O2/c10-4-8-6-1-2-7(3-6)9(8)5-11/h1-2,6-11H,3-5H2/t6-,7+,8+,9- |
| InChIKey | IGHHPVIMEQGKNE-OJOKCITNSA-N |
| SMILES | [H][C@]12C[C@]([H])(C=C1)[C@H](CO)[C@@H]2CO |
Description and Uses
5-Norbornene-2-exo,3-exo-dimethanol can be used for various industrial coatings, such as anti-corrosion, protective, and adhesive coatings.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2906190090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
