A6314212
3-Nitropyrazole , >98.0% , 26621-44-3
CAS NO.：26621-44-3
Empirical Formula: C3H3N3O2
Molecular Weight: 113.07
MDL number: MFCD00159621
EINECS: 640-509-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB20.00 | In Stock |
|
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB61.60 | In Stock |
|
| 100g | RMB220.80 | In Stock |
|
| 500g | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 173-175 °C |
| Boiling point: | 334.0±15.0 °C(Predicted) |
| Density | 1.552±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 8.32±0.10(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C3H3N3O2/c7-6(8)3-1-2-4-5-3/h1-2H,(H,4,5) |
| InChIKey | MZRUFMBFIKGOAL-UHFFFAOYSA-N |
| SMILES | N1C=CC([N+]([O-])=O)=N1 |
| CAS DataBase Reference | 26621-44-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 3(5)-nitropyrazole(26621-44-3) |
Description and Uses
3-Nitro-1H-pyrazole is a pyrazole compound with a nitro functional group, widely used in organic synthesis. The substance can be used in reaction systems such as substitution, nitration or condensation for the preparation of other heterocyclic compounds.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 22-26-36/37/39 |
| HazardClass | IRRITANT |
| HS Code | 2933199090 |
