A6315612
4-Nitrochalcone , >95.0%(HPLC) , 1222-98-6
CAS NO.:1222-98-6
Empirical Formula: C15H11NO3
Molecular Weight: 253.25
MDL number: MFCD00007382
EINECS: 214-949-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB61.60 | In Stock |
|
| 5G | RMB152.80 | In Stock |
|
| 25G | RMB435.20 | In Stock |
|
| 100g | RMB1575.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 158-160 °C (lit.) |
| Boiling point: | 396.45°C (rough estimate) |
| Density | 1.1934 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| form | powder to crystal |
| color | Light orange to Yellow to Green |
| BRN | 400543 |
| InChI | 1S/C15H11NO3/c17-15(13-4-2-1-3-5-13)11-8-12-6-9-14(10-7-12)16(18)19/h1-11H/b11-8+ |
| InChIKey | WDZGGAFMGIOIQS-DHZHZOJOSA-N |
| SMILES | [O-][N+](=O)c1ccc(\C=C\C(=O)c2ccccc2)cc1 |
| CAS DataBase Reference | 1222-98-6(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Propen-1-one, 3-(4-nitrophenyl)-1-phenyl- (1222-98-6) |
Description and Uses
4-Nitrochalcone was used in the synthesis of 2,3-dibromo-4-nitrochalcone.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H303-H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 2 |
| RTECS | FL7075500 |
| TSCA | TSCA listed |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |






