A6319612
4-Nitrobenzhydrazide , >98.0%(HPLC) , 636-97-5
CAS NO.:636-97-5
Empirical Formula: C7H7N3O3
Molecular Weight: 181.15
MDL number: MFCD00007604
EINECS: 211-271-1
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 210-214 °C |
| Boiling point: | 292.97°C (rough estimate) |
| Density | 1.3539 (rough estimate) |
| refractive index | 1.5860 (estimate) |
| solubility | acetone: soluble0.5g/10 mL, clear, yellow |
| pka | 2.77, 11.17(at 25℃) |
| form | crystals |
| color | Yellow |
| PH Range | Colorless (8.2) to yellow (9.5) |
| λmax | 267nm |
| BRN | 519882 |
| Major Application | corrosion inhibitor, disinfectant, cosmetics, paints toothpaste, mouthwash, antifungal agent, inhibit fibrosis, antituberculosis agent |
| InChI | 1S/C7H7N3O3/c8-9-7(11)5-1-3-6(4-2-5)10(12)13/h1-4H,8H2,(H,9,11) |
| InChIKey | FKZXYJYTUSGIQE-UHFFFAOYSA-N |
| SMILES | NNC(=O)c1ccc(cc1)[N+]([O-])=O |
| CAS DataBase Reference | 636-97-5(CAS DataBase Reference) |
| EPA Substance Registry System | 4-Nitrobenzoylhydrazine (636-97-5) |
Description and Uses
4-Nitrobenzoic hydrazide has been used as internal standard in determination of isoniazid in human plasma by LC-MS/MS method.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P305+P351+P338-P280a-P304+P340-P405-P501a |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 36/37/39-26-37/39 |
| WGK Germany | 3 |
| RTECS | DH5670000 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29280000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






