A6325612
6-Nitro-<i>m</i>-cresol , >95.0% , 700-38-9
Synonym(s):
3-Hydroxy-4-nitrotoluene;6-Nitro-m-cresol
CAS NO.：700-38-9
Empirical Formula: C7H7NO3
Molecular Weight: 153.14
MDL number: MFCD00007111
EINECS: 211-843-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB80.80 | In Stock |
|
| 100G | RMB277.60 | In Stock |
|
| 500G | RMB1316.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 53-56 °C(lit.) |
| Boiling point: | 266.03°C (rough estimate) |
| Density | 1.2744 (estimate) |
| refractive index | 1.5744 (estimate) |
| Flash point: | 229 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | pK1:7.41 (25°C,μ=0.1) |
| form | Crystalline Chunks |
| color | Yellow to greenish |
| BRN | 1868030 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C7H7NO3/c1-5-2-3-6(8(10)11)7(9)4-5/h2-4,9H,1H3 |
| InChIKey | NQXUSSVLFOBRSE-UHFFFAOYSA-N |
| SMILES | C1(O)=CC(C)=CC=C1[N+]([O-])=O |
| CAS DataBase Reference | 700-38-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Methyl-2-nitrophenol(700-38-9) |
Description and Uses
5-Methyl-2-nitrophenol was used in the synthesis of 3-methoxy-4-nitrotoluene.
