A6326012
3-Nitro-<i>p</i>-cresol , >98.0% , 2042-14-0
Synonym(s):
3-Nitro-p-cresol;3-Nitro-4-methylphenol;4-Hydroxy-2-nitrotoluene;4-Methyl-5-nitrophenol;NSC 41205
CAS NO.:2042-14-0
Empirical Formula: C7H7NO3
Molecular Weight: 153.14
MDL number: MFCD00007244
EINECS: 218-044-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB24.00 | In Stock |
|
| 10g | RMB38.40 | In Stock |
|
| 25G | RMB86.40 | In Stock |
|
| 100G | RMB232.00 | In Stock |
|
| 500g | RMB1039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 78-81 °C (lit.) |
| Boiling point: | 266.03°C (rough estimate) |
| Density | 1.2744 (estimate) |
| vapor pressure | 0.084Pa at 25℃ |
| refractive index | 1.5744 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Ethyl Acetate, Methanol |
| form | Powder |
| pka | 8.66±0.10(Predicted) |
| color | Pale Yellow Crystalline |
| Water Solubility | Slightly soluble in water. |
| Cosmetics Ingredients Functions | HAIR DYEING |
| InChI | InChI=1S/C7H7NO3/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4,9H,1H3 |
| InChIKey | BQEXDUKMTVYBRK-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(C)C([N+]([O-])=O)=C1 |
| LogP | 2.18 at 25℃ |
| CAS DataBase Reference | 2042-14-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Methyl-3-nitrophenol(2042-14-0) |
Description and Uses
3-Nitro-4-methylphenol (cas# 2042-14-0) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-36 |
| RIDADR | 2446 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29089990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |



