PRODUCT Properties
| Melting point: | 93-94 °C (lit.) |
| Boiling point: | 331.78°C (rough estimate) |
| Density | 1.5671 (rough estimate) |
| refractive index | 1.5282 (estimate) |
| storage temp. | Hygroscopic, Refrigerator, under inert atmosphere |
| solubility | DMSO (Slightly), Ethanol (Slightly, Heated) |
| form | Fine Crystalline Powder |
| color | Yellow |
| Sensitive | Air & Light Sensitive |
| BRN | 384010 |
| InChI | InChI=1S/C8H5NO5/c10-3-5-1-7-8(14-4-13-7)2-6(5)9(11)12/h1-3H,4H2 |
| InChIKey | NRZWECORTTWSEF-UHFFFAOYSA-N |
| SMILES | O1C2=CC([N+]([O-])=O)=C(C=O)C=C2OC1 |
| CAS DataBase Reference | 712-97-0(CAS DataBase Reference) |
Description and Uses
6-Nitropiperonal was used to study the mechanism of aromatic nucleophilic substitution reaction of [18F]Fluoride ion. It was used in the synthesis of 6-[18F]fluoro-L-dopa.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-37 |
| WGK Germany | 3 |
| RTECS | DF4912750 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |



![1-(6-Nitrobenzo[d][1,3]dioxol-5-yl)ethanone](https://img.chemicalbook.com/CAS/GIF/56136-84-6.gif)

