A6330812
Nonadecafluorodecanoic Acid , >98.0%(T) , 335-76-2
Synonym(s):
Nonadecafluorocapric acid;Nonadecafluorodecanoic acid;Perfluorocapric acid;Perfluorodecanoic acid
CAS NO.：335-76-2
Empirical Formula: C10HF19O2
Molecular Weight: 514.08
MDL number: MFCD00004175
EINECS: 206-400-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB111.20 | In Stock |
|
| 5G | RMB415.20 | In Stock |
|
| 25g | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 77-81 °C (lit.) |
| Boiling point: | 218 °C/740 mmHg (lit.) |
| Density | 1.7490 (estimate) |
| vapor pressure | ~10 mm Hg ( 0 °C) |
| Flash point: | 218°C |
| storage temp. | 2-8°C |
| solubility | methanol: soluble10%, clear to very slightly hazy, colorless to faintly yellow |
| pka | 0.52±0.10(Predicted) |
| form | A liquid |
| color | White to Almost white |
| BRN | 1810811 |
| Stability: | Stable. Incompatible with strong bases, oxidizing agents, reducing agents. |
| InChI | 1S/C10HF19O2/c11-2(12,1(30)31)3(13,14)4(15,16)5(17,18)6(19,20)7(21,22)8(23,24)9(25,26)10(27,28)29/h(H,30,31) |
| InChIKey | PCIUEQPBYFRTEM-UHFFFAOYSA-N |
| SMILES | OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 335-76-2(CAS DataBase Reference) |
| EPA Substance Registry System | Perfluorodecanoic acid (335-76-2) |
Description and Uses
Perfluorodecanoic acid was used to evaluate the effect of nonadecafluorocapric acid on the levels of six thyroid function variables (thyroid stimulating hormone, free and total thyroxine, free and total triiodothyronine and thyroglobulin).
Safety
| Symbol(GHS) |   GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301-H351-H360Df-H362 |
| Precautionary statements | P202-P260-P263-P264-P270-P301+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,C |
| Risk Statements | 25-36/37/38 |
| Safety Statements | 26-45 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | HD9900000 |
| Hazard Note | Corrosive |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29159000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Carc. 2 Lact. Repr. 1B |
| Toxicity | LD50 orl-rat: 57 mg/kg TXAPA9 85,169,86 |
