A6336030
5-Bromo-2-nitroanisole , 95% , 103966-66-1
Synonym(s):
4-Bromo-2-methoxy-1-nitrobenzene;5-Bromo-2-nitrophenyl methyl ether
| Pack Size | Price | Stock | Quantity |
| 500mg | RMB79.20 | In Stock |
|
| 1g | RMB110.40 | In Stock |
|
| 5g | RMB383.20 | In Stock |
|
| 25g | RMB1345.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 91-92℃ |
| Boiling point: | 298.7±20.0 °C(Predicted) |
| Density | 1.640 |
| storage temp. | Sealed in dry,Room Temperature |
| form | solid |
| Appearance | Off-white to yellow Solid |
| InChI | InChI=1S/C7H6BrNO3/c1-12-7-4-5(8)2-3-6(7)9(10)11/h2-4H,1H3 |
| InChIKey | DJKPQYBFSAJUBS-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=CC=C(Br)C=C1OC |
Description and Uses
4-Bromo-2-methoxy-1-nitrobenzene (4BMN) is a nucleophile that can be used to optimize the safety profiles of drugs.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 7/9-22-36/37/39-51 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2909303890 |
