A2513012
5-Chloro-2-nitrobenzaldehyde , ≥98.0%(GC) , 6628-86-0
CAS NO.:6628-86-0
Empirical Formula: C7H4ClNO3
Molecular Weight: 185.56
MDL number: MFCD00007289
EINECS: 229-614-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5G | RMB59.20 | In Stock |
|
| 25G | RMB205.60 | In Stock |
|
| 100G | RMB735.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 65-69 °C (lit.) |
| Boiling point: | 310.2±27.0 °C(Predicted) |
| Density | 1.485±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Powder |
| color | Yellow |
| BRN | 1910197 |
| InChI | 1S/C7H4ClNO3/c8-6-1-2-7(9(11)12)5(3-6)4-10/h1-4H |
| InChIKey | SWGPIDCNYAYXMJ-UHFFFAOYSA-N |
| SMILES | [H]C(=O)c1cc(Cl)ccc1[N+]([O-])=O |
| CAS DataBase Reference | 6628-86-0(CAS DataBase Reference) |
Description and Uses
5-Chloro-2-nitrobenzaldehyde is a raw material and intermediate for the plant growth regulator indole ethyl ester (indazole ethyl ester), and also a pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H290-H315-H317-H318-H335-H400 |
| Precautionary statements | P234-P261-P273-P280-P302+P352-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xi,C,F,N |
| Risk Statements | 36/37/38-43-34-14/15-50/53 |
| Safety Statements | 22-24/25-36/37-26-45-43-36/37/39-36-7/8-61 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 3 |
| F | 10 |
| Hazard Note | Irritant |
| HazardClass | 9 |
| PackingGroup | Ⅲ |
| HS Code | 29130000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Eye Dam. 1 Met. Corr. 1 Skin Irrit. 2 Skin Sens. 1 |







