A6340312
<i>N</i>,<i>N</i>'-1,3-Phenylenedimaleimide , >97.0%(HPLC) , 3006-93-7
Synonym(s):
m -Phenylenebismaleimide;N ,N ′-1,3-Phenylenebismaleimide;N ,N -m -Phenylene dimaleimide;1,1′-(1,3-Phenylene)bis[1H -pyrrole-2,5-dione];1,3-Bismaleimidobenzene
CAS NO.：3006-93-7
Empirical Formula: C14H8N2O4
Molecular Weight: 268.22
MDL number: MFCD00022569
EINECS: 221-112-8
| Pack Size | Price | Stock | Quantity |
| 25G | RMB37.60 | In Stock |
|
| 100g | RMB115.20 | In Stock |
|
| 500G | RMB465.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 198-201 °C(lit.) |
| Boiling point: | 411.39°C (rough estimate) |
| Density | 1.3140 (rough estimate) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.5910 (estimate) |
| Flash point: | >208℃ |
| storage temp. | Sealed in dry,Room Temperature |
| pka | -1.67±0.20(Predicted) |
| form | powder to crystal |
| color | Light yellow to Brown to Dark green |
| Water Solubility | negligible soluble |
| InChI | InChI=1S/C14H8N2O4/c17-11-4-5-12(18)15(11)9-2-1-3-10(8-9)16-13(19)6-7-14(16)20/h1-8H |
| InChIKey | IPJGAEWUPXWFPL-UHFFFAOYSA-N |
| SMILES | C1(N2C(=O)C=CC2=O)=CC=CC(N2C(=O)C=CC2=O)=C1 |
| LogP | 0.67 at 24℃ |
| CAS DataBase Reference | 3006-93-7(CAS DataBase Reference) |
| EPA Substance Registry System | 1H-Pyrrole-2,5-dione, 1,1'-(1,3-phenylene)bis- (3006-93-7) |
Description and Uses
rubber vulcanizing agent; rubber crosslinkimg agent
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H302-H330 |
| Precautionary statements | P301+P312+P330-P304+P340+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,Xi,T+ |
| Risk Statements | 23/24/25-36/37/38-26-22 |
| Safety Statements | 27-28-36/37/39-45-38-28A |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | ON6125000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 38220090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 4 Oral |
| Toxicity | LD50 oral in rat: 1370mg/kg |
