S837178
Tris(nonylphenyl) phosphite , 26523-78-4
Synonym(s):
Tri(monononylphenyl) phosphite
CAS NO.：26523-78-4
Empirical Formula: C45H69O3P
Molecular Weight: 689
MDL number: MFCD00015301
EINECS: 247-759-6
| Pack Size | Price | Stock | Quantity |
| 250ml | RMB316.53 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | >360 °C(lit.) |
| Density | 0.99 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| solubility | Benzene (Slightly), Chloroform (Slightly), Methanol (Slightly) |
| form | Thick Oil |
| color | Colourless |
| Specific Gravity | 0.979～0.9870.990 |
| Odor | mild odor |
| Sensitive | Moisture Sensitive |
| Cosmetics Ingredients Functions | ANTIOXIDANT |
| InChIKey | WGKLOLBTFWFKOD-UHFFFAOYSA-N |
| SMILES | P(OC1=CC=CC=C1CCCCCCCCC)(OC1C=CC=CC=1CCCCCCCCC)OC1=CC=CC=C1CCCCCCCCC |
| CAS DataBase Reference | 26523-78-4(CAS DataBase Reference) |
| EPA Substance Registry System | Phenol, nonyl-, phosphite (3:1) (26523-78-4) |
Description and Uses
TNPP in combination with irganox is used to protect polyamide 6 (PA6) from oxidative degradation during the preparation of flame retardant nanocomposites. TNPP can be used as a stabilizer that prevents the molecular weight reduction and increases the tensile strength of the composite. It can also be used as a chain extender to improve the polymeric viscosity during the melt-blending of poly(hydroxybutyrate-co-hydroxyvalerate) based clay nanocomposites which find potential application as packaging materials.
Safety
| Symbol(GHS) |     GHS05,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H315-H317-H318-H361fd-H410 |
| Precautionary statements | P201-P273-P280-P302+P352-P305+P351+P338-P308+P313 |
| Hazard Codes | Xi,N |
| Risk Statements | 43-50/53 |
| Safety Statements | 36/37-61 |
| RIDADR | UN3278 |
| WGK Germany | 2 |
| RTECS | RB2451000 |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | III |
| Hazardous Substances Data | 26523-78-4(Hazardous Substances Data) |
