A6346630
cis-3-Hexenyl propionate , 97% , 33467-74-2
CAS NO.：33467-74-2
Empirical Formula: C9H16O2
Molecular Weight: 156.22
MDL number: MFCD00036534
EINECS: 251-533-2
| Pack Size | Price | Stock | Quantity |
| 25g | RMB97.60 | In Stock |
|
| 100g | RMB354.40 | In Stock |
|
| 500g | RMB1279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -57.45°C (estimate) |
| Boiling point: | 83 °C/17 mmHg(lit.) |
| Density | 0.887 g/mL at 25 °C(lit.) |
| FEMA | 3933 | CIS-3-HEXENYL PROPIONATE |
| refractive index | n20/D 1.43(lit.) |
| Flash point: | 66 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| Odor | at 100.00 %. green fresh fruity apple pear vegetable melon banana peach |
| Appearance | Colorless to light yellow Liquid |
| Odor Type | green |
| biological source | synthetic |
| JECFA Number | 1274 |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C9H16O2/c1-3-5-6-7-8-11-9(10)4-2/h5-6H,3-4,7-8H2,1-2H3/b6-5- |
| InChIKey | LGTLDEUQCOJGFP-WAYWQWQTSA-N |
| SMILES | [H]\C(CC)=C(/[H])CCOC(=O)CC |
| LogP | 2.95 |
| CAS DataBase Reference | 33467-74-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Hexen-1-ol, propanoate, (z)-(33467-74-2) |
| EPA Substance Registry System | 3-Hexen-1-ol, propanoate, (3Z)- (33467-74-2) |
Description and Uses
flavors and fragrances
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| RTECS | MP8645100 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | rabbit,LD50,skin,> 5gm/kg (5000mg/kg),Food and Cosmetics Toxicology. Vol. 17, Pg. 805, 1979. |
