A4741112
cis-3-Hexenyl phenylacetate , ≥99% , 42436-07-7
CAS NO.:42436-07-7
Empirical Formula: C14H18O2
Molecular Weight: 218.29
MDL number: MFCD00036531
EINECS: 255-826-6
| Pack Size | Price | Stock | Quantity |
| 25ML | RMB424.00 | In Stock |
|
| 100ML | RMB719.20 | In Stock |
|
| 500ml | RMB2687.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 292-297 °C (lit.) |
| Density | 0.992 g/mL at 25 °C (lit.) |
| FEMA | 3633 | 3-HEXENYL PHENYLACETATE |
| refractive index | n |
| Flash point: | 110 °C |
| solubility | Insoluble in water, solubic in alcohol and oils. |
| color | Colorless, slightly viscous liquid |
| Odor | Mild and sweet, green-rosy-mossy odor |
| biological source | synthetic |
| Odor Type | green |
| JECFA Number | 1016 |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C14H18O2/c1-2-3-4-8-11-16-14(15)12-13-9-6-5-7-10-13/h3-7,9-10H,2,8,11-12H2,1H3/b4-3- |
| InChIKey | FJKFIIYSBXHBCT-ARJAWSKDSA-N |
| SMILES | [H]\C(CC)=C(/[H])CCOC(=O)Cc1ccccc1 |
| LogP | 4.20 |
| CAS DataBase Reference | 42436-07-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Cis-3-hexenyl phenyl acetate(42436-07-7) |
| EPA Substance Registry System | Benzeneacetic acid, (3Z)-3-hexenyl ester (42436-07-7) |
Description and Uses
3-Hexenyl phenylacetate has a mild and sweet, green-rose-mossy odor. May be synthesized from phenylacetyl chloride and cis- 3-hexenol with pyridine catalyst in an inert diluent.
Safety
| Hazard statements | H413 |
| PPE | Eyeshields, Gloves |
| WGK Germany | 2 |
| RTECS | CY1630000 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |





