BD0697453
(Z)-Hex-3-en-1-yl2-hydroxybenzoate , 99+% , 65405-77-8
CAS NO.:65405-77-8
Empirical Formula: C13H16O3
Molecular Weight: 220.26
MDL number: MFCD00036486
EINECS: 265-745-8
| Pack Size | Price | Stock | Quantity |
| 5g | RMB40.80 | In Stock |
|
| 25g | RMB137.60 | In Stock |
|
| 100g | RMB453.60 | In Stock |
|
| 500g | RMB1679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 271 °C(lit.) |
| Density | 1.059 g/mL at 25 °C(lit.) |
| vapor pressure | 0.15Pa at 25℃ |
| refractive index | n |
| FEMA | 4750 | CIS-3-HEXENYL SALICYLATE |
| Flash point: | >230 °F |
| storage temp. | 2-8°C, stored under nitrogen |
| solubility | Chloroform (Sparingly), Methanol (Sparingly) |
| form | Oil |
| pka | 8.12±0.30(Predicted) |
| Specific Gravity | 1.059 |
| color | Colourless |
| Odor | at 100.00 %. floral green metallic herbal balsam |
| Odor Type | floral |
| biological source | synthetic |
| Water Solubility | 5mg/L at 20℃ |
| JECFA Number | 2275 |
| Stability: | Light Sensitive |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C13H16O3/c1-2-3-4-7-10-16-13(15)11-8-5-6-9-12(11)14/h3-6,8-9,14H,2,7,10H2,1H3/b4-3- |
| InChIKey | IEPWIPZLLIOZLU-ARJAWSKDSA-N |
| SMILES | [H]\C(CC)=C(/[H])CCOC(=O)c1ccccc1O |
| LogP | 4.8 at 25℃ |
| CAS DataBase Reference | 65405-77-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Cis-3-hexenyl salicylate(65405-77-8) |
| EPA Substance Registry System | Benzoic acid, 2-hydroxy-, (3Z)-3-hexenyl ester (65405-77-8) |
Description and Uses
flavors and fragrances
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| RTECS | VO3500000 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







