A6349530
1-(N，N-Dimethylsulfamoyl)-1H-imidazole , 97% , 78162-58-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB44.64 | In Stock |
|
| 1g | RMB85.60 | In Stock |
|
| 5g | RMB301.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 48-51 °C (lit.) |
| Boiling point: | 83-87 °C(Press: 0.6 Torr) |
| Density | 1.35±0.1 g/cm3(Predicted) |
| Flash point: | 230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 2.41±0.10(Predicted) |
| color | Pale Yellow |
| InChI | InChI=1S/C5H9N3O2S/c1-7(2)11(9,10)8-4-3-6-5-8/h3-5H,1-2H3 |
| InChIKey | YRRWNBMOJMMXQY-UHFFFAOYSA-N |
| SMILES | C1N(S(N(C)C)(=O)=O)C=CN=1 |
| CAS DataBase Reference | 78162-58-0(CAS DataBase Reference) |
Description and Uses
1-(N,N-Dimethylsulfamoyl)-1H-imidazole is an Imidazole (I350200) derivative, used in the preparation of Histamine H3 Receptor Agonists and druglike angiotensin II compounds with affinity for the AT2 receptor.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT |
| HS Code | 2933299090 |
