A6350212
Naphthacene (purified by sublimation) , >98.0%(HPLC) , 92-24-0
Synonym(s):
2,3-Benzanthracene;Naphthacene;Tetracene
CAS NO.:92-24-0
Empirical Formula: C18H12
Molecular Weight: 228.29
MDL number: MFCD00003702
EINECS: 202-138-9
| Pack Size | Price | Stock | Quantity |
| 200MG | RMB503.20 | In Stock |
|
| 1G | RMB1640.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| Boiling point: | 305.1°C (rough estimate) |
| Density | 1.35 |
| refractive index | 1.5500 (estimate) |
| form | Crystalline Powder |
| color | Orange |
| Water Solubility | 1.507ug/L(25 ºC) |
| semiconductor properties | P-type (mobility=0.4cm2/V·s) |
| λmax | 277 nm |
| Merck | 14,6369 |
| BRN | 1909299 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C18H12/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1/h1-12H |
| InChIKey | IFLREYGFSNHWGE-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=C3C(=C2)C=C2C(C=CC=C2)=C3)=CC=C1 |
| CAS DataBase Reference | 92-24-0(CAS DataBase Reference) |
| EPA Substance Registry System | Naphthacene (92-24-0) |
Description and Uses
p-Type organic conductor and OLED dopant. Sublimed grade for organic electronic device applications.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P261-P280 |
| Hazard Codes | Xn,N |
| Risk Statements | 40-50/53 |
| Safety Statements | 45-36/37-61-60-24/25 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | QI7605000 |
| HS Code | 29029090 |







