A6353312
6-Nitroanthranilic Acid , >97.0%(HPLC) , 50573-74-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB33.60 | In Stock |
|
| 1G | RMB57.60 | In Stock |
|
| 5G | RMB154.40 | In Stock |
|
| 25G | RMB638.40 | In Stock |
|
| 100g | RMB2428.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 189 °C (decomp) |
| Boiling point: | 412.3±35.0 °C(Predicted) |
| Density | 1.568±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| pka | 2.11±0.30(Predicted) |
| form | Solid |
| color | Light yellow to Brown |
| InChI | InChI=1S/C7H6N2O4/c8-4-2-1-3-5(9(12)13)6(4)7(10)11/h1-3H,8H2,(H,10,11) |
| InChIKey | GGKYLHNARFFORH-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=C([N+]([O-])=O)C=CC=C1N |
Description and Uses
2-Amino-6-nitrobenzoic Acid is the secondary metabolite of dinitrobenzyl glucuronide related to the formation of genotoxic compound of dinitrotoluene in rats.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| HS Code | 2921490090 |
