A6371412
N-<WBR>(1)<WBR>-<WBR>Boc-<WBR>5-<WBR>aminoindazole , 98% , 129488-10-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB97.60 | In Stock |
|
| 5g | RMB371.20 | In Stock |
|
| 25g | RMB1088.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 395.3±34.0 °C(Predicted) |
| Density | 1.24±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| form | solid |
| pka | 3.08±0.10(Predicted) |
| Appearance | Brown to red Solid |
| InChI | InChI=1S/C12H15N3O2/c1-12(2,3)17-11(16)15-10-5-4-9(13)6-8(10)7-14-15/h4-7H,13H2,1-3H3 |
| InChIKey | LRSDPIIWOZRHNJ-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)C2=C(C=C(N)C=C2)C=N1 |
Description and Uses
tert-Butyl 5-Amino-1H-indazole-1-carboxylate is an intermediate to prepare protein kinase inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| HS Code | 2933998090 |
