A6381212
3-Nitrophenyl isocyanate , 97% , 3320-87-4
CAS NO.:3320-87-4
Empirical Formula: C7H4N2O3
Molecular Weight: 164.12
MDL number: MFCD00007220
EINECS: 222-025-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB207.20 | In Stock |
|
| 25G | RMB946.40 | In Stock |
|
| 100g | RMB2270.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 51-52 °C(lit.) |
| Boiling point: | 130-131 °C11 mm Hg(lit.) |
| Density | 1.5018 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| form | Crystalline Solid |
| color | Yellow |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C7H4N2O3/c10-5-8-6-2-1-3-7(4-6)9(11)12/h1-4H |
| InChIKey | GFFGYTMCNVMFAJ-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cccc(c1)N=C=O |
| CAS DataBase Reference | 3320-87-4(CAS DataBase Reference) |
| EPA Substance Registry System | Benzene, 1-isocyanato-3-nitro- (3320-87-4) |
Description and Uses
3-Nitrophenyl isocyanate may be used in chemical synthesis studies.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H315-H317-H319-H334-H335 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38-42/43 |
| Safety Statements | 22-26-36/37-45 |
| RIDADR | 2206 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29291090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |







