A6447912
N,N'-Dimethyl-1,2-cyclohexanediamine , 95% , 61798-24-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB82.40 | In Stock |
|
| 5G | RMB134.40 | In Stock |
|
| 25G | RMB911.20 | In Stock |
|
| 100g | RMB2064.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 78-80 °C18 mm Hg(lit.) |
| Density | 0.902 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 165 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 11.04±0.40(Predicted) |
| form | liquid |
| color | Colourlessto light yellow |
| optical activity | 0.48° (C=0.66 g/100ml,CHCL3) |
| InChI | InChI=1S/C8H18N2/c1-9-7-5-3-4-6-8(7)10-2/h7-10H,3-6H2,1-2H3 |
| InChIKey | JRHPOFJADXHYBR-UHFFFAOYSA-N |
| SMILES | C1(NC)CCCCC1NC |
| CAS DataBase Reference | 61798-24-1(CAS DataBase Reference) |
Description and Uses
N,N''-Dimethyl-1,2-cyclohexanediamine is used as a catalyst in the synthesis of substituted pyrazoles with anti-inflammatory activity. As well as highly functional pyridines and bipyridines.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P271-P261-P280 |
| Hazard Codes | C |
| Risk Statements | 22-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2735 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | Ⅱ |
| HS Code | 29213099 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |



