PRODUCT Properties
| Melting point: | >300 °C (dec.) (lit.) |
| Density | 1.567±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 7.27±0.10(Predicted) |
| form | Solid |
| color | White to Pale Yellow |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C5H4N2O3/c8-2-3-1-6-5(10)7-4(3)9/h1-2H,(H2,6,7,9,10) |
| InChIKey | OHAMXGZMZZWRCA-UHFFFAOYSA-N |
| SMILES | C1(=O)NC=C(C=O)C(=O)N1 |
| CAS DataBase Reference | 1195-08-0(CAS DataBase Reference) |
Description and Uses
5-Formyluracil may be used for the preparation of covalently linked base with 5-aminocytosine pair via Schiff base formation.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29349990 |






