A6495412
4-Nitroisoindolin-1-one , 95% , 366452-97-3
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB187.20 | In Stock |
|
| 250MG | RMB483.12 | In Stock |
|
| 1g | RMB976.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 488.8±45.0 °C(Predicted) |
| Density | 1.449±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 12.69±0.20(Predicted) |
| Appearance | Off-white to light yellow Solid |
| InChI | InChI=1S/C8H6N2O3/c11-8-5-2-1-3-7(10(12)13)6(5)4-9-8/h1-3H,4H2,(H,9,11) |
| InChIKey | RTDDSWLIZLMORY-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C([N+]([O-])=O)=CC=C2)CN1 |
Description and Uses
4-Nitroisoindolin-1-one is a reactant that has been used in the synthesis of 4-(N-acyl)-2,3-dihydro-1H-isoindol-1-ones as potent inhibitors of poly(ADP-ribose) polymerase-1 (PARP-1).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| HS Code | 2933998090 |
