BD1513232
4-Bromoisoindolin-1-one , 97% , 337536-15-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB40.00 | In Stock |
|
| 1g | RMB84.00 | In Stock |
|
| 5g | RMB312.80 | In Stock |
|
| 10g | RMB545.60 | In Stock |
|
| 25g | RMB1120.80 | In Stock |
|
| 100g | RMB4404.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 448.9±45.0 °C(Predicted) |
| Density | 1.666 |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 13.69±0.20(Predicted) |
| form | solid |
| color | Off-white to light yellow |
| InChI | InChI=1S/C8H6BrNO/c9-7-3-1-2-5-6(7)4-10-8(5)11/h1-3H,4H2,(H,10,11) |
| InChIKey | TYRICULVJRGSTL-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C(Br)=CC=C2)CN1 |
Description and Uses
4-bromoisoindolin-1-one can be used as organic synthesis intermediate and pharmaceutical intermediate, mainly used in laboratory research and development process and chemical production process.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H332-H315-H319-H335 |
| Precautionary statements | P260-P280-P312 |
| HS Code | 2933790090 |
