N-Acetylcytidine , 95% , 3768-18-1
CAS NO.:3768-18-1
Empirical Formula: C11H15N3O6
Molecular Weight: 285.25
MDL number: MFCD00006540
EINECS: 223-195-6
| Pack Size | Price | Stock | Quantity | 
| 250MG | RMB23.20 | In Stock | 
                                                 | 
                                        
| 1G | RMB42.40 | In Stock | 
                                                 | 
                                        
| 5g | RMB108.80 | In Stock | 
                                                 | 
                                        
| 25g | RMB377.60 | In Stock | 
                                                 | 
                                        
| 100g | RMB1193.60 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
PRODUCT Properties
| Melting point: | 199 °C (dec.)(lit.) | 
                                    
| Density | 1.72±0.1 g/cm3(Predicted) | 
                                    
| storage temp. | Sealed in dry,Store in freezer, under -20°C | 
                                    
| solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated) | 
                                    
| pka | 10.21±0.20(Predicted) | 
                                    
| form | Solid | 
                                    
| color | White to Pale Yellow | 
                                    
| PH | <1.5 | 
                                    
| λmax | 247,297 (pH 7) | 
                                    
| InChI | InChI=1S/C11H15N3O6/c1-5(16)12-7-2-3-14(11(19)13-7)10-9(18)8(17)6(4-15)20-10/h2-3,6,8-10,15,17-18H,4H2,1H3,(H,12,13,16,19)/t6-,8-,9-,10-/m1/s1 | 
                                    
| InChIKey | NIDVTARKFBZMOT-PEBGCTIMSA-N | 
                                    
| SMILES | OC[C@H]1O[C@@H](N2C=CC(NC(C)=O)=NC2=O)[C@H](O)[C@@H]1O | 
                                    
| CAS DataBase Reference | 3768-18-1(CAS DataBase Reference) | 
                                    
| NIST Chemistry Reference | Cytidine, n-acetyl-(3768-18-1) | 
                                    
Description and Uses
                                            N4-Acetylcytidine is a modified nucleoside and endogenous urinary nucleoside product of the degradation of tRNA. N4-Acetylcytidine is a biological marker for various cancers with elevated concentrations present in urine. tRNA has been shown to be excreted in abnormal amounts in the urine of cancer patients. tRNA from neoplastic tissue had a much more rapid turnover rate than the tRNA from the corresponding normal tissue. Evidence indicates that methylation of tRNA occurs only after synthesis of the intact macromolecule. Because there are no specific enzyme systems to incorporate the modified nucleosides into the macromolecular nucleic acid, these nucleosides once released in the process of tRNA turnover cannot be reutilized, nor are they further degraded, but are excreted in urine.
N4-Acetylcytidine is also a partially protected cytidine and therefore can be used as a synthetic building block to prepare further derivatized nucleosides such as 2’,3’-dideoxycytidine.
                                        
N4-Acetylcytidine (cas# 3768-18-1) is a nucleotide-derived metabolite used as biomarkers for diagnosis of inflammation-related diseases.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H302+H312+H332-H315-H319-H335 | 
| Precautionary statements | P280 | 
| Hazard Codes | Xn | 
| Risk Statements | 20/21/22-36/37/38 | 
| Safety Statements | 36-36/37/39-26 | 
| WGK Germany | 3 | 
| HS Code | 29335990 | 







