BD8254531
5-Acetylpyrimidine , 95% , 10325-70-9
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB111.20 | In Stock |
|
| 250mg | RMB172.00 | In Stock |
|
| 1g | RMB346.40 | In Stock |
|
| 5g | RMB1352.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 87-88 °C |
| Boiling point: | 70 °C(Press: 2 Torr) |
| Density | 1.136 |
| Flash point: | 92.1℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | solid |
| pka | 1.03±0.10(Predicted) |
| color | Pale yellow |
| InChI | InChI=1S/C6H6N2O/c1-5(9)6-2-7-4-8-3-6/h2-4H,1H3 |
| InChIKey | COTYNDRSENVEFI-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CN=CN=C1)C |
| NIST Chemistry Reference | 5-Acetylpyrimidine(10325-70-9) |
Description and Uses
5-Acetylpyrimidine is a substituted pyrimidine used in the study for prediction of relative potency of ketone protease inhibitors using molecular orbital theory.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Safety Statements | 24/25 |
| HS Code | 29335990 |
