A6497312
n-Pentylboronic acid , 98% , 4737-50-2
CAS NO.：4737-50-2
Empirical Formula: C5H13BO2
Molecular Weight: 115.97
MDL number: MFCD01074651
EINECS: 808-197-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5g | RMB92.80 | In Stock |
|
| 25g | RMB399.20 | In Stock |
|
| 100g | RMB1423.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 94°C(lit.) |
| Boiling point: | 207.9±23.0 °C(Predicted) |
| Density | 0.905±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Chloroform, DMSO |
| pka | 10.37±0.43(Predicted) |
| form | solid |
| color | white to off-white |
| InChI | InChI=1S/C5H13BO2/c1-3-4-5(2)6(7)8/h5,7-8H,3-4H2,1-2H3 |
| InChIKey | RGTLYZSQOQHZAT-UHFFFAOYSA-N |
| SMILES | CC(B(O)O)CCC |
Description and Uses
N-Pentylboronic Acid is used in the synthesis of (-)-Δ8-THC and (-)-Δ9-THC. Also it aids in the synthesis of boronic acid inhibitors of endothelial lipase.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280-P305+P351+P338-P304+P340-P405-P501A |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37 |
| TSCA | No |
| HS Code | 2931900090 |
