T9653330
n-Octylboronic Acid (contains varying amounts of Anhydride) , 28741-08-4
CAS NO.：28741-08-4
Empirical Formula: C8H19BO2
Molecular Weight: 158.05
MDL number: MFCD01074560
EINECS: 681-714-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB120.00 | In Stock |
|
| 5g | RMB472.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 78-81°C |
| Boiling point: | 262.6±23.0 °C(Predicted) |
| Density | 0.890±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| form | powder to crystal |
| pka | 10.39±0.43(Predicted) |
| color | White to Almost white |
| Water Solubility | Insoluble in water. |
| Sensitive | Air Sensitive |
| BRN | 1739759 |
| InChI | InChI=1S/C8H19BO2/c1-3-4-5-6-7-8(2)9(10)11/h8,10-11H,3-7H2,1-2H3 |
| InChIKey | GKFRVXOKPXCXAK-UHFFFAOYSA-N |
| SMILES | CC(B(O)O)CCCCCC |
| CAS DataBase Reference | 28741-08-4(CAS DataBase Reference) |
Description and Uses
1-Octylboronic acid is used as an organic chemical synthesis intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| HS Code | 2931900090 |
