A6524912
Oleylamine , C18:80-90% , 112-90-3
Synonym(s):
cis-1-Amino-9-octadecene
CAS NO.:112-90-3
Empirical Formula: C18H37N
Molecular Weight: 267.49
MDL number: MFCD00066507
EINECS: 204-015-5
| Pack Size | Price | Stock | Quantity |
| 25ML | RMB28.80 | In Stock |
|
| 100ML | RMB43.20 | In Stock |
|
| 250ml | RMB77.60 | In Stock |
|
| 500ML | RMB126.40 | In Stock |
|
| 1L | RMB226.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 18-26 °C (lit.) |
| Boiling point: | 348-350 °C (lit.) |
| Density | 0.813 g/mL at 25 °C (lit.) |
| vapor pressure | 8 mm Hg ( 135 °C) |
| refractive index | n |
| Flash point: | 310 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | liquid |
| pka | 10.67±0.10(Predicted) |
| color | colorless |
| Odor | slt amine/lemon odor |
| Water Solubility | insoluble |
| BRN | 1723960 |
| Stability: | Stable. Incompatible with acids, acid chlorides, acid anhydrides, oxidizing agents. |
| Cosmetics Ingredients Functions | ANTISTATIC |
| InChI | 1S/C18H37N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19/h9-10H,2-8,11-19H2,1H3/b10-9- |
| InChIKey | QGLWBTPVKHMVHM-MDZDMXLPSA-N |
| SMILES | [H]\C(CCCCCCCC)=C(/[H])CCCCCCCCN |
| LogP | 7.780 (est) |
| CAS DataBase Reference | 112-90-3(CAS DataBase Reference) |
| EPA Substance Registry System | Oleylamine (112-90-3) |
Description and Uses
Used in the chemical synthesis and capping of nanoparticles such as Fe3O4, poly (2-hydroxyethyl methacrylate)-graft-poly (ε-caprolactone), titania, mesoporous silica.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS05,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H304-H314-H335-H373-H410 |
| Precautionary statements | P260-P280-P301+P310-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,N |
| Risk Statements | 34-22-50/53 |
| Safety Statements | 26-36/37/39-45-24/25 |
| RIDADR | UN 2735 8/PG 2 |
| WGK Germany | 2 |
| RTECS | RG4130000 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29215900 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Asp. Tox. 1 Eye Dam. 1 Skin Corr. 1B STOT RE 2 STOT SE 3 |
| Hazardous Substances Data | 112-90-3(Hazardous Substances Data) |
| Toxicity | LD50 intraperitoneal in mouse: 888mg/kg |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







