A6528412
n-Octyl-β-D-Thioglucopyranoside , 99% , 85618-21-9
Synonym(s):
Octyl thioglucoside;OSGP
CAS NO.:85618-21-9
Empirical Formula: C14H28O5S
Molecular Weight: 308.43
MDL number: MFCD00012189
EINECS: 617-729-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB335.20 | In Stock |
|
| 5G | RMB1339.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 125-131 °C |
| alpha | -46 º (c=1, MeOH) |
| Boiling point: | 418.82°C (rough estimate) |
| Density | 1.1831 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | −20°C |
| solubility | ethanol: soluble50mg/mL, clear, colorless |
| pka | 13.02±0.70(Predicted) |
| form | crystalline |
| color | White |
| biological source | synthetic |
| optical activity | [α]/D -52 to -48°, c = 1 in ethanol |
| Water Solubility | soluble |
| BRN | 4182783 |
| InChI | 1S/C14H28O5S/c1-2-3-4-5-6-7-8-20-14-13(18)12(17)11(16)10(9-15)19-14/h10-18H,2-9H2,1H3 |
| InChIKey | CGVLVOOFCGWBCS-RQASJOBOSA-N |
| SMILES | S(C1OC(C(C(C1O)O)O)CO)CCCCCCCC |
| CAS DataBase Reference | 85618-21-9(CAS DataBase Reference) |
Description and Uses
A non-ionic detergent for solubilization and reconstitution of membrane proteins of Escherichia coli.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-37/39-26 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |





