N-Octyl-β-D-glucopyranoside , 98%, for protein analysis , 29836-26-8
Synonym(s):
n-Octyl glucoside;Octyl β-D -glucopyranoside;octyl glucoside; OG; OGP;Octyl-β-D -glucopyranoside solution;OGP
CAS NO.:29836-26-8
Empirical Formula: C14H28O6
Molecular Weight: 292.37
MDL number: MFCD00063288
EINECS: 249-887-8
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB159.20 | In Stock |
|
| 1G | RMB364.80 | In Stock |
|
| 5G | RMB1279.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 105 °C |
| Boiling point: | 354.3°C (rough estimate) |
| alpha | -32 º (c=5, water) |
| Density | 1.0869 (rough estimate) |
| refractive index | -27 ° (C=1, MeOH) |
| storage temp. | -20°C |
| solubility | DMSO (Slightly), Water (Slightly) |
| pka | 12.95±0.70(Predicted) |
| form | Crystalline Powder and Chunks |
| color | White |
| Water Solubility | 3 g/10 mL |
| Sensitive | Hygroscopic |
| Merck | 14,6767 |
| BRN | 84118 |
| Stability: | Hygroscopic |
| Cosmetics Ingredients Functions | SURFACTANT - CLEANSING CLEANSING |
| Cosmetic Ingredient Review (CIR) | n-Octyl-β-D-glucopyranoside (29836-26-8) |
| InChI | 1S/C14H28O6/c1-2-3-4-5-6-7-8-19-14-13(18)12(17)11(16)10(9-15)20-14/h10-18H,2-9H2,1H3/t10-,11-,12+,13-,14-/m1/s1 |
| InChIKey | HEGSGKPQLMEBJL-QNOVJUQQSA-N |
| SMILES | O1[C@H]([C@@H]([C@H]([C@@H]([C@H]1CO)O)O)O)OCCCCCCCC |
| LogP | 0.887 (est) |
| CAS DataBase Reference | 29836-26-8(CAS DataBase Reference) |
| EPA Substance Registry System | Octyl .beta.-D-glucopyranoside (29836-26-8) |
Description and Uses
n-Octyl-β-D-glucopyranoside is a non–ionic detergent intended for solubilizing membrane–bound proteins in their native state and for the preparation of lipid vesicles. n-Octyl-β-D-glucopyranoside has a well–defined chemical structure, small uniform micelles, and high water solubility, which make n-Octyl-β-D-glucopyranoside superior to most other nonionic detergents for membrane solubilization. Because of the high critical micelle concentration (20-25 mM), n-Octyl-β-D-glucopyranoside has the additional advantage of being removed easily by dialysis when compared to bile salts. n-Octyl-β-D-glucopyranoside is also known as N-Octyl glucoside, OGP, OG, n-Octylglucoside, and octyl-β-D-glucopyranoside.
Unlike many other detergents, octyl glucoside is a pure, single compound of defined structure. Very effective for insulin binding and solubilization studies of membran
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29400090 |
| Storage Class | 13 - Non Combustible Solids |






