A6534012
Oxfendazole , Analysis standard , 53716-50-0
Synonym(s):
Methyl 5-(phenylsulfinyl)-benzimidazol-2-carbamate
CAS NO.:53716-50-0
Empirical Formula: C15H13N3O3S
Molecular Weight: 315.35
MDL number: MFCD00133728
EINECS: 258-714-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB727.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 298-300?C |
| Density | 1.3229 (rough estimate) |
| refractive index | 1.6740 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMF: slightly soluble; DMSO: 1 mg/ml; DMSO:PBS (pH 7.2) (1:4): 0.20 mg/ml |
| form | Solid |
| pka | 10.27±0.10(Predicted) |
| color | Crystals from chloroform-methanol |
| Merck | 14,6935 |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | InChI=1S/C15H13N3O3S/c1-21-15(19)18-14-16-12-8-7-11(9-13(12)17-14)22(20)10-5-3-2-4-6-10/h2-9H,1H3,(H2,16,17,18,19) |
| InChIKey | BEZZFPOZAYTVHN-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)NC1NC2=CC(S(C3=CC=CC=C3)=O)=CC=C2N=1 |
| CAS DataBase Reference | 53716-50-0(CAS DataBase Reference) |
Description and Uses
PAF inhibitor
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H360D-H373-H410 |
| Precautionary statements | P202-P260-P273-P280-P308+P313-P391 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 36 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| RTECS | FD0835000 |
| HS Code | 29339900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Repr. 1B STOT RE 2 |
| Toxicity | LD50 in dogs, rats, mice: >1600, >6400, >6400 mg/kg (Averkin) |







