M7976847
Fenbendazolesulfone(HOE5151) , 98% , 54029-20-8
Synonym(s):
5-Benzenesulfonyl-1H-benzoimidazol-2-yl)carbamic acid methyl ester;Methyl 5-(phenylsulfonyl)-2-benzimidazolecarbamate
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB3350.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300°C |
| Density | 1.486±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | DMF: 10 mg/ml; DMSO: 10 mg/ml |
| pka | 10.14±0.10(Predicted) |
| BRN | 703211 |
| Major Application | clinical testing |
| InChI | 1S/C15H13N3O4S/c1-22-15(19)18-14-16-12-8-7-11(9-13(12)17-14)23(20,21)10-5-3-2-4-6-10/h2-9H,1H3,(H2,16,17,18,19) |
| InChIKey | UAFDGCOOJPIAHN-UHFFFAOYSA-N |
| SMILES | COC(=O)Nc1nc2cc(ccc2[nH]1)S(=O)(=O)c3ccccc3 |
| CAS DataBase Reference | 54029-20-8 |
Description and Uses
Fenbendazole sulfone is a minor metabolite of the anthelmintic fenbendazole[1]. Fenbendazole undergoes oxidation to form oxfendazole, which is further oxidized to form fenbendazole sulfone.
A metabolite of Fenbendazole (F246750).
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H315-H317-H410 |
| Precautionary statements | P261-P264-P273-P280-P301+P312-P302+P352 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-38 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Irrit. 2 Skin Sens. 1 |
