A6534812
(-)-2,3-O-Isopropylidene-2,3-dihydroxy-1,4-bis(diphenylphosphino)butane , 98% , 32305-98-9
Synonym(s):
(−)-1,4-Bis(diphenylphosphino)-1,4-dideoxy-2,3-O-isopropylidene-L-threitol;(R,R)-DIOP;(4R,5R)-4,5-Bis(diphenylphosphino-methyl)-2,2-dimethyl-1,3-dioxolane;(4R-trans)-[(2,2-Dimethyl-1,3-dioxolane-4,5-diyl)bis(methylene)]bis(diphenylphosphine)
CAS NO.:32305-98-9
Empirical Formula: C31H32O2P2
Molecular Weight: 498.54
MDL number: MFCD00014107
EINECS: 250-984-2
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB197.60 | In Stock |
|
| 1G | RMB645.60 | In Stock |
|
| 5G | RMB3061.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 88-90 °C(lit.) |
| alpha | -26° (c 2.0, CHCl3) |
| Boiling point: | 590.3±25.0 °C(Predicted) |
| storage temp. | 2-8°C |
| form | Powder |
| color | white |
| optical activity | [α]19/D 26°, c = 2.3 in chloroform |
| Sensitive | Air Sensitive |
| BRN | 1441045 |
| InChIKey | VCHDBLPQYJAQSQ-KYJUHHDHSA-N |
| SMILES | CC1(C)O[C@@H](CP(c2ccccc2)c3ccccc3)[C@H](CP(c4ccccc4)c5ccccc5)O1 |
Description and Uses
For the in situ preparation of chiral hydrogenation catalysts.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| F | 10-23 |
| TSCA | No |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



![(-)-4,5-Bis[hydroxy(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolane](https://img.chemicalbook.com/CAS/GIF/93379-48-7.gif)



