A6535912
5′-O-(4,4′-Dimethoxytrityl)thymidine , 98% , 40615-39-2
Synonym(s):
DMT-T
CAS NO.:40615-39-2
Empirical Formula: C31H32N2O7
Molecular Weight: 544.59
MDL number: MFCD00010113
EINECS: 255-003-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB57.60 | In Stock |
|
| 5G | RMB119.20 | In Stock |
|
| 25G | RMB408.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 114-116 °C (subl.)(lit.) |
| Boiling point: | 618.41°C (rough estimate) |
| Density | 1.2483 (rough estimate) |
| vapor pressure | 0Pa at 20℃ |
| refractive index | 7 ° (C=1, MeOH) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 9.55±0.10(Predicted) |
| form | Powder |
| color | White to off-white |
| Water Solubility | 3mg/L at 20℃ |
| BRN | 599297 |
| Stability: | Store in Freezer |
| InChIKey | UBTJZUKVKGZHAD-UPRLRBBYSA-N |
| SMILES | COc1ccc(cc1)C(OC[C@H]2O[C@H](C[C@@H]2O)N3C=C(C)C(=O)NC3=O)(c4ccccc4)c5ccc(OC)cc5 |
| LogP | 4.61 at 20℃ |
| CAS DataBase Reference | 40615-39-2(CAS DataBase Reference) |
| EPA Substance Registry System | Thymidine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]- (40615-39-2) |
Description and Uses
5'-O-(4,4'-Dimethoxytrityl)thymidine is used in the solid-phase synthesis of polynucleotides and polythymidylic acids by the block coupling phosphotriester method. Further, it is used in the stereoselective synthesis of 3'-deoxy-3'-threo-hydroxymethyl nucleoside. In addition to this, it is used as a research tool for antiviral and anticancer studies.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H413 |
| Precautionary statements | P273 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 1-3-10 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29349990 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Aquatic Chronic 4 |





