A6539012
4,7,10,13,16,19,22,25-Octaoxahexacosanoic acid , 97% , 1093647-41-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB1585.60 | In Stock |
|
| 5G | RMB5279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 503.0±50.0 °C(Predicted) |
| Density | 1.111±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | Soluble in Water, DMSO, DCM, DMF |
| pka | 4.28±0.10(Predicted) |
| form | Solid-Liquid Mixture |
| color | Colorless to light yellow |
| InChI | InChI=1S/C18H36O10/c1-21-4-5-23-8-9-25-12-13-27-16-17-28-15-14-26-11-10-24-7-6-22-3-2-18(19)20/h2-17H2,1H3,(H,19,20) |
| InChIKey | JHUSQXBQANBSDC-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCOCCOCCOCCOCCOCCOCCOCCOC |
Description and Uses
m-PEG8-acid is a PEG linker containing a terminal carboxylic acid. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The hydrophilic PEG spacer increases solubility in aqueous media.
Applications may include: bioconjugation, drug delivery, PEG hydrogel, crosslinker, and surface functionalization
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |




![O-(2-Aminoethyl)-O′-[2-(Boc-amino)ethyl]octaethylene glycol](https://img.chemicalbook.com/CAS/GIF/890091-43-7.gif)


