A6540312
N-n-Octyl-D-glucamine , 98% , 23323-37-7
CAS NO.：23323-37-7
Empirical Formula: C14H31NO5
Molecular Weight: 293.4
MDL number: MFCD00134352
EINECS: 245-582-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 250MG | RMB23.20 | In Stock |
|
| 25G | RMB24.00 | In Stock |
|
| 5G | RMB27.20 | In Stock |
|
| 100G | RMB66.40 | In Stock |
|
| 500G | RMB249.60 | In Stock |
|
| 2.5kg | RMB1072.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 121-124 °C(lit.) |
| alpha | -15 º (c=1, MeOH) |
| Boiling point: | 524.7±50.0 °C(Predicted) |
| Density | 1.139±0.06 g/cm3(Predicted) |
| refractive index | -19 ° (C=0.5, MeOH) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated), Water (Slightly) |
| form | Solid |
| pka | 13.47±0.20(Predicted) |
| color | White to Off-White |
| optical activity | [α]20/D 15°, c = 1 in methanol |
| InChI | InChI=1S/C14H31NO5/c1-2-3-4-5-6-7-8-15-9-11(17)13(19)14(20)12(18)10-16/h11-20H,2-10H2,1H3/t11-,12+,13+,14+/m0/s1 |
| InChIKey | ZRRNJJURLBXWLL-REWJHTLYSA-N |
| SMILES | C(NCCCCCCCC)[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O |
| CAS DataBase Reference | 23323-37-7(CAS DataBase Reference) |
Description and Uses
1-Deoxy-1-(octylamino)-D-glucitol is used in the preparation of Dexketoprofen Trometamol.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-24/25 |
| WGK Germany | 3 |
| HS Code | 29221990 |
