BD1544832
4-Fluoro-N-isopropylaniline , 96% , 70441-63-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB197.60 | In Stock |
|
| 1g | RMB513.60 | In Stock |
|
| 5g | RMB1796.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 214℃ |
| Density | 1.045 |
| vapor pressure | 0.1-0.9Pa at 20-50℃ |
| Flash point: | 83℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 5.91±0.32(Predicted) |
| Appearance | Light brown to brown Liquid |
| InChI | InChI=1S/C9H12FN/c1-7(2)11-9-5-3-8(10)4-6-9/h3-7,11H,1-2H3 |
| InChIKey | RMXBOQCXULAXBO-UHFFFAOYSA-N |
| SMILES | C1(NC(C)C)=CC=C(F)C=C1 |
| LogP | 2.3 at 23℃ and pH5.59 |
| Surface tension | 56.68mN/m at 989.9mg/L and 20℃ |
| EPA Substance Registry System | Benzenamine, 4-fluoro-N-(1-methylethyl)- (70441-63-3) |
Description and Uses
4-Fluoro-N-isopropylaniline is an intermediate used in the synthesis of Flufenacet, a herbicide.
Safety
| Symbol(GHS) |     GHS07,GHS08,GHS09,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H317-H341-H411-H331-H372 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P201-P202-P281-P308+P313-P405-P501-P261-P272-P280-P302+P352-P333+P313-P321-P363-P501-P260-P264-P270-P314-P501-P261-P271-P304+P340-P311-P321-P403+P233-P405-P501-P264-P270-P301+P310-P321-P330-P405-P501 |
| RIDADR | 2810 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 2921490090 |
